C45H63N5O8 — CID 174068097
3-[(2S,3S)-13-ethyl-8-(hydroxymethylidene)-3,7,12,17,20-pentamethyl-3,21-dihydro-2H-porphyrin-2-yl]-N,N-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]propanamide (PubChem CID 174068097) has the molecular formula C45H63N5O8 and a molecular weight of 802.03 g/mol. Its IUPAC name is 3-[(2S,3S)-13-ethyl-8-(hydroxymethylidene)-3,7,12,17,20-pentamethyl-3,21-dihydro-2H-porphyrin-2-yl]-N,N-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]propanamide.
| Compound Name | 3-[(2S,3S)-13-ethyl-8-(hydroxymethylidene)-3,7,12,17,20-pentamethyl-3,21-dihydro-2H-porphyrin-2-yl]-N,N-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 174068097 |
| Molecular Formula | C45H63N5O8 |
| Molecular Weight | 802.03 g/mol |
| Exact Mass | 801.47 |
| IUPAC Name | 3-[(2S,3S)-13-ethyl-8-(hydroxymethylidene)-3,7,12,17,20-pentamethyl-3,21-dihydro-2H-porphyrin-2-yl]-N,N-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]propanamide |
| SMILES | CCC1=C(C)/C2=C/C3=NC(=C(C)C3=CO)/C=C3\N/C(=C(/C)C4=N/C(=C\C1=N2)C(C)=C4)[C@@H](CCC(=O)N(CCOCCOCCOC)CCOCCOCCOC)[C@@H]3C |
| InChI | InChI=1S/C45H63N5O8/c1-9-34-30(3)40-27-43-36(28-51)32(5)39(48-43)26-41-31(4)35(45(49-41)33(6)38-24-29(2)37(46-38)25-42(34)47-40)10-11-44(52)50(12-14-55-20-22-57-18-16-53-7)13-15-56-21-23-58-19-17-54-8/h24-28,31,35,49,51H,9-23H2,1-8H3/b36-28?,37-25-,40-27-,41-26-,45-33-/t31-,35-/m0/s1 |
| InChIKey | XGKZBMUSIJEODM-HFOONSMESA-N |
| XLogP | 6.50 |
| TPSA | 145.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.03 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|