C44H40BNO3 — CID 174068415
16,22-ditert-butyl-6,11-diphenoxy-19-oxa-2-aza-1-boraheptacyclo[12.11.1.12,9.03,8.018,26.020,25.013,27]heptacosa-3(8),4,9(27),10,12,14(26),15,17,20(25),21,23-undecaene (PubChem CID 174068415) has the molecular formula C44H40BNO3 and a molecular weight of 641.62 g/mol. Its IUPAC name is 16,22-ditert-butyl-6,11-diphenoxy-19-oxa-2-aza-1-boraheptacyclo[12.11.1.12,9.03,8.018,26.020,25.013,27]heptacosa-3(8),4,9(27),10,12,14(26),15,17,20(25),21,23-undecaene.
| Compound Name | 16,22-ditert-butyl-6,11-diphenoxy-19-oxa-2-aza-1-boraheptacyclo[12.11.1.12,9.03,8.018,26.020,25.013,27]heptacosa-3(8),4,9(27),10,12,14(26),15,17,20(25),21,23-undecaene |
|---|---|
| PubChem CID | 174068415 |
| Molecular Formula | C44H40BNO3 |
| Molecular Weight | 641.62 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | 16,22-ditert-butyl-6,11-diphenoxy-19-oxa-2-aza-1-boraheptacyclo[12.11.1.12,9.03,8.018,26.020,25.013,27]heptacosa-3(8),4,9(27),10,12,14(26),15,17,20(25),21,23-undecaene |
| SMILES | CC(C)(C)c1ccc2c(c1)Oc1cc(C(C)(C)C)cc3c1B2n1c2c(c4cc(Oc5ccccc5)cc-3c41)CC(Oc1ccccc1)C=C2 |
| InChI | InChI=1S/C44H40BNO3/c1-43(2,3)27-17-19-37-39(22-27)49-40-23-28(44(4,5)6)21-34-36-26-32(48-30-15-11-8-12-16-30)25-35-33-24-31(47-29-13-9-7-10-14-29)18-20-38(33)46(42(35)36)45(37)41(34)40/h7-23,25-26,31H,24H2,1-6H3 |
| InChIKey | KKZHTYHEWXKLEE-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.62 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|