C24H32F3N5OSi — CID 174069014
N-[(3S)-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]-4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 174069014) has the molecular formula C24H32F3N5OSi and a molecular weight of 491.63 g/mol. Its IUPAC name is N-[(3S)-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]-4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(3S)-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]-4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 174069014 |
| Molecular Formula | C24H32F3N5OSi |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | N-[(3S)-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]-4-(1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC1CNC[C@@H](Nc2ncc(C(F)(F)F)c(-c3c[nH]c4ccccc34)n2)C1 |
| InChI | InChI=1S/C24H32F3N5OSi/c1-23(2,3)34(4,5)33-16-10-15(11-28-12-16)31-22-30-14-19(24(25,26)27)21(32-22)18-13-29-20-9-7-6-8-17(18)20/h6-9,13-16,28-29H,10-12H2,1-5H3,(H,30,31,32)/t15-,16?/m0/s1 |
| InChIKey | OOLMIYYDOGTOAM-VYRBHSGPSA-N |
| XLogP | 5.81 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|