C23H14B6F3N9O3 — CID 174069163
CID 174069163 (PubChem CID 174069163) has the molecular formula C23H14B6F3N9O3 and a molecular weight of 586.29 g/mol.
| Compound Name | CID 174069163 |
|---|---|
| PubChem CID | 174069163 |
| Molecular Formula | C23H14B6F3N9O3 |
| Molecular Weight | 586.29 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N(C(=O)Nc1cc(Oc2cnc3nc(Nc4cc(C(F)(F)F)cn(C)c4=O)n(C)c3c2C#N)ccn1)C([B])([B])[B] |
| InChI | InChI=1S/C23H14B6F3N9O3/c1-39-9-10(21(30,31)32)5-13(18(39)42)36-19-38-17-16(40(19)2)12(7-33)14(8-35-17)44-11-3-4-34-15(6-11)37-20(43)41(22(24,25)26)23(27,28)29/h3-6,8-9H,1-2H3,(H,34,37,43)(H,35,36,38) |
| InChIKey | GRIWXZPWNURUPM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|