C26H34BFN5OP — CID 174069625
CID 174069625 (PubChem CID 174069625) has the molecular formula C26H34BFN5OP and a molecular weight of 493.38 g/mol.
| Compound Name | CID 174069625 |
|---|---|
| PubChem CID | 174069625 |
| Molecular Formula | C26H34BFN5OP |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | — |
| SMILES | [B]C(C)(P)c1cn2c(NC3CCC(NC(=O)c4ccc(N(C)CC(C)F)cc4)CC3)cccc2n1 |
| InChI | InChI=1S/C26H34BFN5OP/c1-17(28)15-32(3)21-13-7-18(8-14-21)25(34)30-20-11-9-19(10-12-20)29-23-5-4-6-24-31-22(16-33(23)24)26(2,27)35/h4-8,13-14,16-17,19-20,29H,9-12,15,35H2,1-3H3,(H,30,34) |
| InChIKey | SBTUJDPIRQCQJK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|