C17H23O6P — CID 174069662
formyl-[(E)-2-[(2R,3R,4S,5S)-4-methoxy-5-phenyl-3-propan-2-yloxyoxolan-2-yl]ethenyl]phosphinic acid (PubChem CID 174069662) has the molecular formula C17H23O6P and a molecular weight of 354.34 g/mol. Its IUPAC name is formyl-[(E)-2-[(2R,3R,4S,5S)-4-methoxy-5-phenyl-3-propan-2-yloxyoxolan-2-yl]ethenyl]phosphinic acid.
| Compound Name | formyl-[(E)-2-[(2R,3R,4S,5S)-4-methoxy-5-phenyl-3-propan-2-yloxyoxolan-2-yl]ethenyl]phosphinic acid |
|---|---|
| PubChem CID | 174069662 |
| Molecular Formula | C17H23O6P |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | formyl-[(E)-2-[(2R,3R,4S,5S)-4-methoxy-5-phenyl-3-propan-2-yloxyoxolan-2-yl]ethenyl]phosphinic acid |
| SMILES | CO[C@@H]1[C@H](OC(C)C)[C@@H](/C=C/P(=O)(O)C=O)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H23O6P/c1-12(2)22-16-14(9-10-24(19,20)11-18)23-15(17(16)21-3)13-7-5-4-6-8-13/h4-12,14-17H,1-3H3,(H,19,20)/b10-9+/t14-,15+,16-,17+/m1/s1 |
| InChIKey | IWJDGYFQJHJJDF-WCXLXNRASA-N |
| XLogP | 2.91 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|