C54H41BF2N2O — CID 174069959
2,2-difluoro-8-(2-methoxyphenyl)-4,12-bis(4-methylphenyl)-6,10-bis(4-phenylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 174069959) has the molecular formula C54H41BF2N2O and a molecular weight of 782.74 g/mol. Its IUPAC name is 2,2-difluoro-8-(2-methoxyphenyl)-4,12-bis(4-methylphenyl)-6,10-bis(4-phenylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-8-(2-methoxyphenyl)-4,12-bis(4-methylphenyl)-6,10-bis(4-phenylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 174069959 |
| Molecular Formula | C54H41BF2N2O |
| Molecular Weight | 782.74 g/mol |
| Exact Mass | 782.33 |
| IUPAC Name | 2,2-difluoro-8-(2-methoxyphenyl)-4,12-bis(4-methylphenyl)-6,10-bis(4-phenylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COc1ccccc1C1=C2C(c3ccc(-c4ccccc4)cc3)=CC(c3ccc(C)cc3)=[N+]2[B-](F)(F)n2c(-c3ccc(C)cc3)cc(-c3ccc(-c4ccccc4)cc3)c21 |
| InChI | InChI=1S/C54H41BF2N2O/c1-36-18-22-44(23-19-36)49-34-47(42-30-26-40(27-31-42)38-12-6-4-7-13-38)53-52(46-16-10-11-17-51(46)60-3)54-48(43-32-28-41(29-33-43)39-14-8-5-9-15-39)35-50(45-24-20-37(2)21-25-45)59(54)55(56,57)58(49)53/h4-35H,1-3H3 |
| InChIKey | IFCRIIUKMBRDCY-UHFFFAOYSA-N |
| XLogP | 13.38 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.74 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|