C40H29BFN2O+ — CID 174069981
2-fluoro-8-(2-methoxyphenyl)-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 174069981) has the molecular formula C40H29BFN2O+ and a molecular weight of 583.50 g/mol. Its IUPAC name is 2-fluoro-8-(2-methoxyphenyl)-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2-fluoro-8-(2-methoxyphenyl)-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 174069981 |
| Molecular Formula | C40H29BFN2O+ |
| Molecular Weight | 583.50 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | 2-fluoro-8-(2-methoxyphenyl)-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COc1ccccc1C1=C2C(c3ccccc3)=CC(c3ccccc3)=[N+]2B(F)n2c(-c3ccccc3)cc(-c3ccccc3)c21 |
| InChI | InChI=1S/C40H29BFN2O/c1-45-37-25-15-14-24-32(37)38-39-33(28-16-6-2-7-17-28)26-35(30-20-10-4-11-21-30)43(39)41(42)44-36(31-22-12-5-13-23-31)27-34(40(38)44)29-18-8-3-9-19-29/h2-27H,1H3/q+1 |
| InChIKey | AUBGNVCWLRRIMV-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.50 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|