C22H31N5O2 — CID 174070625
6-ethyl-2-N-[3-[(E)-2-(1-ethylpyrrolidin-3-yl)ethenoxy]-4-methoxyphenyl]-4-N-methylpyrimidine-2,4-diamine (PubChem CID 174070625) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 6-ethyl-2-N-[3-[(E)-2-(1-ethylpyrrolidin-3-yl)ethenoxy]-4-methoxyphenyl]-4-N-methylpyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-2-N-[3-[(E)-2-(1-ethylpyrrolidin-3-yl)ethenoxy]-4-methoxyphenyl]-4-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174070625 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 6-ethyl-2-N-[3-[(E)-2-(1-ethylpyrrolidin-3-yl)ethenoxy]-4-methoxyphenyl]-4-N-methylpyrimidine-2,4-diamine |
| SMILES | CCc1cc(NC)nc(Nc2ccc(OC)c(O/C=C/C3CCN(CC)C3)c2)n1 |
| InChI | InChI=1S/C22H31N5O2/c1-5-17-14-21(23-3)26-22(24-17)25-18-7-8-19(28-4)20(13-18)29-12-10-16-9-11-27(6-2)15-16/h7-8,10,12-14,16H,5-6,9,11,15H2,1-4H3,(H2,23,24,25,26)/b12-10+ |
| InChIKey | SBTDJKVOGTYEJP-ZRDIBKRKSA-N |
| XLogP | 4.07 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|