C23H30ClFN4O3 — CID 174070732
(6R)-4-[amino-[4-chloro-6-[(1S)-1-[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione (PubChem CID 174070732) has the molecular formula C23H30ClFN4O3 and a molecular weight of 464.97 g/mol. Its IUPAC name is (6R)-4-[amino-[4-chloro-6-[(1S)-1-[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione.
| Compound Name | (6R)-4-[amino-[4-chloro-6-[(1S)-1-[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
|---|---|
| PubChem CID | 174070732 |
| Molecular Formula | C23H30ClFN4O3 |
| Molecular Weight | 464.97 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (6R)-4-[amino-[4-chloro-6-[(1S)-1-[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
| SMILES | C[C@H](Oc1cc(Cl)nc(C(N)=C2CCC[C@@]3(CCCCC3=O)C2=O)n1)[C@@H]1C[C@H](F)CN1C |
| InChI | InChI=1S/C23H30ClFN4O3/c1-13(16-10-14(25)12-29(16)2)32-19-11-18(24)27-22(28-19)20(26)15-6-5-9-23(21(15)31)8-4-3-7-17(23)30/h11,13-14,16H,3-10,12,26H2,1-2H3/t13-,14-,16-,23+/m0/s1 |
| InChIKey | QKXFPOFBMRRKLG-OVZGXMNKSA-N |
| XLogP | 3.49 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.97 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|