About 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide
2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide (PubChem CID 174070750) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide.
Molecular Properties
| Compound Name | 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide |
| PubChem CID | 174070750 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide |
| SMILES | [H]/N=C(\N)C(N)=C1CCC[C@@]2(CCCCC2=O)C1=O |
| InChI | InChI=1S/C13H19N3O2/c14-10(12(15)16)8-4-3-7-13(11(8)18)6-2-1-5-9(13)17/h1-7,14H2,(H3,15,16)/t13-/m1/s1 |
| InChIKey | DCSBIEIOXYQTCQ-CYBMUJFWSA-N |
| XLogP | 1.02 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide?
The IUPAC name of 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide (CID 174070750) is 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide.
What is the SMILES notation for 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide?
The canonical SMILES for 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide is [H]/N=C(\N)C(N)=C1CCC[C@@]2(CCCCC2=O)C1=O.
What is the InChIKey of 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide?
The InChIKey is DCSBIEIOXYQTCQ-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H19N3O2/c14-10(12(15)16)8-4-3-7-13(11(8)18)6-2-1-5-9(13)17/h1-7,14H2,(H3,15,16)/t13-/m1/s1.
What are the key properties of 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide?
2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide has a molecular weight of 249.31 g/mol, XLogP of 1.02, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]ethanimidamide is sourced from PubChem (CID 174070750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).