C22H38N4OS2 — CID 174070866
(3E,5E,7E)-N-[dimethyl(sulfanyl)-λ4-sulfanyl]-N,3-dimethyl-8-(1-methylimidazol-2-yl)-6-(3-methylmorpholin-4-yl)nona-3,5,7-trien-4-amine (PubChem CID 174070866) has the molecular formula C22H38N4OS2 and a molecular weight of 438.71 g/mol. Its IUPAC name is (3E,5E,7E)-N-[dimethyl(sulfanyl)-λ4-sulfanyl]-N,3-dimethyl-8-(1-methylimidazol-2-yl)-6-(3-methylmorpholin-4-yl)nona-3,5,7-trien-4-amine.
| Compound Name | (3E,5E,7E)-N-[dimethyl(sulfanyl)-λ4-sulfanyl]-N,3-dimethyl-8-(1-methylimidazol-2-yl)-6-(3-methylmorpholin-4-yl)nona-3,5,7-trien-4-amine |
|---|---|
| PubChem CID | 174070866 |
| Molecular Formula | C22H38N4OS2 |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (3E,5E,7E)-N-[dimethyl(sulfanyl)-λ4-sulfanyl]-N,3-dimethyl-8-(1-methylimidazol-2-yl)-6-(3-methylmorpholin-4-yl)nona-3,5,7-trien-4-amine |
| SMILES | CC/C(C)=C(\C=C(/C=C(\C)c1nccn1C)N1CCOCC1C)N(C)S(C)(C)S |
| InChI | InChI=1S/C22H38N4OS2/c1-9-17(2)21(25(6)29(7,8)28)15-20(26-12-13-27-16-19(26)4)14-18(3)22-23-10-11-24(22)5/h10-11,14-15,19,28H,9,12-13,16H2,1-8H3/b18-14+,20-15+,21-17+ |
| InChIKey | AEPLYOFJZBOURE-GTWPUMMBSA-N |
| XLogP | 4.87 |
| TPSA | 33.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|