C27H40N6O3 — CID 174071001
(6R)-4-[amino-[4-(1-amino-3-iminoprop-1-enyl)-6-[(2S,3S)-3-methyl-6-(methylamino)hexan-2-yl]oxypyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione (PubChem CID 174071001) has the molecular formula C27H40N6O3 and a molecular weight of 496.66 g/mol. Its IUPAC name is (6R)-4-[amino-[4-(1-amino-3-iminoprop-1-enyl)-6-[(2S,3S)-3-methyl-6-(methylamino)hexan-2-yl]oxypyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione.
| Compound Name | (6R)-4-[amino-[4-(1-amino-3-iminoprop-1-enyl)-6-[(2S,3S)-3-methyl-6-(methylamino)hexan-2-yl]oxypyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
|---|---|
| PubChem CID | 174071001 |
| Molecular Formula | C27H40N6O3 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | (6R)-4-[amino-[4-(1-amino-3-iminoprop-1-enyl)-6-[(2S,3S)-3-methyl-6-(methylamino)hexan-2-yl]oxypyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
| SMILES | [H]/N=C/C=C(N)c1cc(O[C@@H](C)[C@@H](C)CCCNC)nc(C(N)=C2CCC[C@@]3(CCCCC3=O)C2=O)n1 |
| InChI | InChI=1S/C27H40N6O3/c1-17(8-7-15-31-3)18(2)36-23-16-21(20(29)11-14-28)32-26(33-23)24(30)19-9-6-13-27(25(19)35)12-5-4-10-22(27)34/h11,14,16-18,28,31H,4-10,12-13,15,29-30H2,1-3H3/b20-11?,24-19?,28-14+/t17-,18-,27+/m0/s1 |
| InChIKey | WOAKMXWDJLOSBT-GRFLHMFCSA-N |
| XLogP | 3.38 |
| TPSA | 157.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|