C28H45FN2S — CID 174071300
3-[1-[(Z)-3-ethyl-4-methylpent-2-en-2-yl]-3-[(2S,3S,4S)-5-fluoro-2,3,4-trimethylhept-6-enyl]-4,5-dihydro-2H-benzimidazol-2-yl]prop-1-ene-2-thiol (PubChem CID 174071300) has the molecular formula C28H45FN2S and a molecular weight of 460.75 g/mol. Its IUPAC name is 3-[1-[(Z)-3-ethyl-4-methylpent-2-en-2-yl]-3-[(2S,3S,4S)-5-fluoro-2,3,4-trimethylhept-6-enyl]-4,5-dihydro-2H-benzimidazol-2-yl]prop-1-ene-2-thiol.
| Compound Name | 3-[1-[(Z)-3-ethyl-4-methylpent-2-en-2-yl]-3-[(2S,3S,4S)-5-fluoro-2,3,4-trimethylhept-6-enyl]-4,5-dihydro-2H-benzimidazol-2-yl]prop-1-ene-2-thiol |
|---|---|
| PubChem CID | 174071300 |
| Molecular Formula | C28H45FN2S |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | 3-[1-[(Z)-3-ethyl-4-methylpent-2-en-2-yl]-3-[(2S,3S,4S)-5-fluoro-2,3,4-trimethylhept-6-enyl]-4,5-dihydro-2H-benzimidazol-2-yl]prop-1-ene-2-thiol |
| SMILES | C=CC(F)[C@@H](C)[C@@H](C)[C@H](C)CN1C2=C(C=CCC2)N(/C(C)=C(/CC)C(C)C)C1CC(=C)S |
| InChI | InChI=1S/C28H45FN2S/c1-10-24(18(3)4)23(9)31-27-15-13-12-14-26(27)30(28(31)16-20(6)32)17-19(5)21(7)22(8)25(29)11-2/h11,13,15,18-19,21-22,25,28,32H,2,6,10,12,14,16-17H2,1,3-5,7-9H3/b24-23-/t19-,21+,22+,25?,28?/m1/s1 |
| InChIKey | CZNJMEMGFNCNDC-NHIFFYCKSA-N |
| XLogP | 8.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|