C24H21BN2O3 — CID 174071306
CID 174071306 (PubChem CID 174071306) has the molecular formula C24H21BN2O3 and a molecular weight of 396.26 g/mol.
| Compound Name | CID 174071306 |
|---|---|
| PubChem CID | 174071306 |
| Molecular Formula | C24H21BN2O3 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)ncn2Cc1ccccc1OCc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C24H21BN2O3/c25-20-10-11-22-21(13-20)26-16-27(22)14-19-3-1-2-4-23(19)30-15-18-7-5-17(6-8-18)9-12-24(28)29/h1-8,10-11,13,16H,9,12,14-15H2,(H,28,29) |
| InChIKey | RDBGTUUIHLKZIA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|