C48H25B5O — CID 174071627
CID 174071627 (PubChem CID 174071627) has the molecular formula C48H25B5O and a molecular weight of 671.79 g/mol.
| Compound Name | CID 174071627 |
|---|---|
| PubChem CID | 174071627 |
| Molecular Formula | C48H25B5O |
| Molecular Weight | 671.79 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2c3ccccc3c(-c3cccc4ccccc34)c3ccc(-c4cc(-c5ccccc5)c5oc6ccccc6c5c4)cc23)c([B])c1[B] |
| InChI | InChI=1S/C48H25B5O/c49-43-42(44(50)46(52)47(53)45(43)51)41-34-18-7-6-17-33(34)40(32-19-10-14-26-13-4-5-15-30(26)32)35-22-21-28(23-37(35)41)29-24-36(27-11-2-1-3-12-27)48-38(25-29)31-16-8-9-20-39(31)54-48/h1-25H |
| InChIKey | IVPOELLLLYHONZ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.79 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|