C15H15BFN3O — CID 174072405
CID 174072405 (PubChem CID 174072405) has the molecular formula C15H15BFN3O and a molecular weight of 283.12 g/mol.
| Compound Name | CID 174072405 |
|---|---|
| PubChem CID | 174072405 |
| Molecular Formula | C15H15BFN3O |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | — |
| SMILES | [B]C(O)(c1nc2n(n1)[C@H](c1ccccc1)C[C@@H]2F)C1CC1 |
| InChI | InChI=1S/C15H15BFN3O/c16-15(21,10-6-7-10)14-18-13-11(17)8-12(20(13)19-14)9-4-2-1-3-5-9/h1-5,10-12,21H,6-8H2/t11-,12-,15?/m0/s1 |
| InChIKey | QHBSQZTXOMHXLU-GYZKLXCISA-N |
| XLogP | 2.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|