C39H19B5N4S — CID 174072873
CID 174072873 (PubChem CID 174072873) has the molecular formula C39H19B5N4S and a molecular weight of 629.74 g/mol.
| Compound Name | CID 174072873 |
|---|---|
| PubChem CID | 174072873 |
| Molecular Formula | C39H19B5N4S |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 630.18 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3ccccc3)nc(-c3cccc(-n4c5ccccc5c5ccc6c7ccccc7sc6c54)c3)n2)c([B])c1[B] |
| InChI | InChI=1S/C39H19B5N4S/c40-30-29(31(41)33(43)34(44)32(30)42)39-46-37(20-9-2-1-3-10-20)45-38(47-39)21-11-8-12-22(19-21)48-27-15-6-4-13-23(27)25-17-18-26-24-14-5-7-16-28(24)49-36(26)35(25)48/h1-19H |
| InChIKey | KRPWEAGSUYWDOD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|