C51H26B5N3O2 — CID 174073416
CID 174073416 (PubChem CID 174073416) has the molecular formula C51H26B5N3O2 and a molecular weight of 766.85 g/mol.
| Compound Name | CID 174073416 |
|---|---|
| PubChem CID | 174073416 |
| Molecular Formula | C51H26B5N3O2 |
| Molecular Weight | 766.85 g/mol |
| Exact Mass | 767.25 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2ccc(-c3ccc(-c4ccc5c(c4)oc4cc(-c6nc(-c7ccccc7)nc(-c7cccc8c7oc7ccccc78)n6)ccc45)cc3)cc2)c([B])c1[B] |
| InChI | InChI=1S/C51H26B5N3O2/c52-43-42(44(53)46(55)47(56)45(43)54)30-19-17-28(18-20-30)27-13-15-29(16-14-27)32-21-23-35-36-24-22-33(26-41(36)60-40(35)25-32)50-57-49(31-7-2-1-3-8-31)58-51(59-50)38-11-6-10-37-34-9-4-5-12-39(34)61-48(37)38/h1-26H |
| InChIKey | JJSVACFYXHVSNM-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.85 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|