C26H34N6O4 — CID 174073456
(6R)-4-[amino-[4-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]-6-(1,3-oxazol-2-ylamino)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione (PubChem CID 174073456) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is (6R)-4-[amino-[4-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]-6-(1,3-oxazol-2-ylamino)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione.
| Compound Name | (6R)-4-[amino-[4-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]-6-(1,3-oxazol-2-ylamino)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
|---|---|
| PubChem CID | 174073456 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (6R)-4-[amino-[4-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]-6-(1,3-oxazol-2-ylamino)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
| SMILES | C[C@H](Oc1cc(Nc2ncco2)nc(C(N)=C2CCC[C@@]3(CCCCC3=O)C2=O)n1)[C@@H]1CCCN1C |
| InChI | InChI=1S/C26H34N6O4/c1-16(18-8-6-13-32(18)2)36-21-15-20(30-25-28-12-14-35-25)29-24(31-21)22(27)17-7-5-11-26(23(17)34)10-4-3-9-19(26)33/h12,14-16,18H,3-11,13,27H2,1-2H3,(H,28,29,30,31)/t16-,18-,26+/m0/s1 |
| InChIKey | QZYCYDGLGZANPH-KLHYBKMASA-N |
| XLogP | 3.62 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|