C39H13B10N3OS — CID 174073499
CID 174073499 (PubChem CID 174073499) has the molecular formula C39H13B10N3OS and a molecular weight of 679.74 g/mol.
| Compound Name | CID 174073499 |
|---|---|
| PubChem CID | 174073499 |
| Molecular Formula | C39H13B10N3OS |
| Molecular Weight | 679.74 g/mol |
| Exact Mass | 681.17 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3ccc4oc5cc(-c6cccc7c6sc6ccccc67)ccc5c4c3)nc(-c3c([B])c([B])c([B])c([B])c3[B])n2)c([B])c1[B] |
| InChI | InChI=1S/C39H13B10N3OS/c40-26-24(27(41)31(45)34(48)30(26)44)38-50-37(51-39(52-38)25-28(42)32(46)35(49)33(47)29(25)43)15-9-11-21-20(12-15)17-10-8-14(13-22(17)53-21)16-5-3-6-19-18-4-1-2-7-23(18)54-36(16)19/h1-13H |
| InChIKey | KOMCZAMOZAPDPG-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.74 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|