C45H23B5N4O — CID 174073672
CID 174073672 (PubChem CID 174073672) has the molecular formula C45H23B5N4O and a molecular weight of 689.77 g/mol.
| Compound Name | CID 174073672 |
|---|---|
| PubChem CID | 174073672 |
| Molecular Formula | C45H23B5N4O |
| Molecular Weight | 689.77 g/mol |
| Exact Mass | 690.23 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2cccc3c2c2ccccc2n3-c2nc(-c3ccccc3)nc(-c3cccc4c3oc3cccc(-c5ccccc5)c34)n2)c([B])c1[B] |
| InChI | InChI=1S/C45H23B5N4O/c46-37-36(38(47)40(49)41(50)39(37)48)28-18-10-22-32-34(28)27-16-7-8-21-31(27)54(32)45-52-43(25-14-5-2-6-15-25)51-44(53-45)30-20-9-19-29-35-26(24-12-3-1-4-13-24)17-11-23-33(35)55-42(29)30/h1-23H |
| InChIKey | MZKVXOSDKZZYFY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|