About (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole
(3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole (PubChem CID 174074877) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole |
| PubChem CID | 174074877 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole |
| SMILES | C=C[C@@H]1NNC=C1C |
| InChI | InChI=1S/C6H10N2/c1-3-6-5(2)4-7-8-6/h3-4,6-8H,1H2,2H3/t6-/m0/s1 |
| InChIKey | HOECBBZRMXKNPN-LURJTMIESA-N |
| XLogP | 0.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole?
The IUPAC name of (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole (CID 174074877) is (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole.
What is the SMILES notation for (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole?
The canonical SMILES for (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole is C=C[C@@H]1NNC=C1C.
What is the InChIKey of (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole?
The InChIKey is HOECBBZRMXKNPN-LURJTMIESA-N. The full InChI is InChI=1S/C6H10N2/c1-3-6-5(2)4-7-8-6/h3-4,6-8H,1H2,2H3/t6-/m0/s1.
What are the key properties of (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole?
(3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole has a molecular weight of 110.16 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-ethenyl-4-methyl-2,3-dihydro-1H-pyrazole is sourced from PubChem (CID 174074877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).