C21H22BClN2O3 — CID 174075055
8-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 174075055) has the molecular formula C21H22BClN2O3 and a molecular weight of 396.68 g/mol. Its IUPAC name is 8-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 8-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 174075055 |
| Molecular Formula | C21H22BClN2O3 |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 8-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cnc2cc(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3Cl)ccn2c1=O |
| InChI | InChI=1S/C21H22BClN2O3/c1-13-12-24-17-11-14(9-10-25(17)19(13)26)15-7-6-8-16(18(15)23)22-27-20(2,3)21(4,5)28-22/h6-12H,1-5H3 |
| InChIKey | UZPABLYMDDKHDB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|