C46H35N3O — CID 174075559
2-(7,8-dihydrophenanthren-9-yl)-4-[3-[(5R)-5-methyl-1,2,5,6-tetrahydronaphthalen-2-yl]dibenzofuran-1-yl]-6-phenyl-1,3,5-triazine (PubChem CID 174075559) has the molecular formula C46H35N3O and a molecular weight of 645.81 g/mol. Its IUPAC name is 2-(7,8-dihydrophenanthren-9-yl)-4-[3-[(5R)-5-methyl-1,2,5,6-tetrahydronaphthalen-2-yl]dibenzofuran-1-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(7,8-dihydrophenanthren-9-yl)-4-[3-[(5R)-5-methyl-1,2,5,6-tetrahydronaphthalen-2-yl]dibenzofuran-1-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174075559 |
| Molecular Formula | C46H35N3O |
| Molecular Weight | 645.81 g/mol |
| Exact Mass | 645.28 |
| IUPAC Name | 2-(7,8-dihydrophenanthren-9-yl)-4-[3-[(5R)-5-methyl-1,2,5,6-tetrahydronaphthalen-2-yl]dibenzofuran-1-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C[C@@H]1CC=CC2=C1C=CC(c1cc(-c3nc(-c4ccccc4)nc(-c4cc5ccccc5c5c4CCC=C5)n3)c3c(c1)oc1ccccc13)C2 |
| InChI | InChI=1S/C46H35N3O/c1-28-12-11-16-31-24-30(22-23-34(28)31)33-26-40(43-38-20-9-10-21-41(38)50-42(43)27-33)46-48-44(29-13-3-2-4-14-29)47-45(49-46)39-25-32-15-5-6-17-35(32)36-18-7-8-19-37(36)39/h2-7,9-11,13-18,20-23,25-28,30H,8,12,19,24H2,1H3/t28-,30?/m1/s1 |
| InChIKey | RKXIWWGJYGCTJN-KFMIKNBQSA-N |
| XLogP | 11.82 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.81 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |