C30H35BClN3O4 — CID 174075577
(5S)-5-[[[6-[3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-methoxy-3-pyridinyl]methylamino]methyl]pyrrolidin-2-one (PubChem CID 174075577) has the molecular formula C30H35BClN3O4 and a molecular weight of 547.89 g/mol. Its IUPAC name is (5S)-5-[[[6-[3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-methoxy-3-pyridinyl]methylamino]methyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[[[6-[3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-methoxy-3-pyridinyl]methylamino]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 174075577 |
| Molecular Formula | C30H35BClN3O4 |
| Molecular Weight | 547.89 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | (5S)-5-[[[6-[3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-methoxy-3-pyridinyl]methylamino]methyl]pyrrolidin-2-one |
| SMILES | COc1nc(-c2cccc(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3Cl)c2)ccc1CNC[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C30H35BClN3O4/c1-29(2)30(3,4)39-31(38-29)24-11-7-10-23(27(24)32)19-8-6-9-20(16-19)25-14-12-21(28(35-25)37-5)17-33-18-22-13-15-26(36)34-22/h6-12,14,16,22,33H,13,15,17-18H2,1-5H3,(H,34,36)/t22-/m0/s1 |
| InChIKey | PWHASCNDHSUDKD-QFIPXVFZSA-N |
| XLogP | 4.74 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.89 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|