C20H22ClFN4O2 — CID 174076175
(6-chloro-4-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-[4-[(E)-1-(ethylideneamino)-2-fluorobut-1-en-3-ynyl]piperazin-1-yl]methanone (PubChem CID 174076175) has the molecular formula C20H22ClFN4O2 and a molecular weight of 404.87 g/mol. Its IUPAC name is (6-chloro-4-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-[4-[(E)-1-(ethylideneamino)-2-fluorobut-1-en-3-ynyl]piperazin-1-yl]methanone.
| Compound Name | (6-chloro-4-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-[4-[(E)-1-(ethylideneamino)-2-fluorobut-1-en-3-ynyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 174076175 |
| Molecular Formula | C20H22ClFN4O2 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (6-chloro-4-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-[4-[(E)-1-(ethylideneamino)-2-fluorobut-1-en-3-ynyl]piperazin-1-yl]methanone |
| SMILES | C#C/C(F)=C(\N=CC)N1CCN(C(=O)N2CCC(O)c3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C20H22ClFN4O2/c1-3-16(22)19(23-4-2)24-9-11-25(12-10-24)20(28)26-8-7-18(27)15-13-14(21)5-6-17(15)26/h1,4-6,13,18,27H,7-12H2,2H3/b19-16-,23-4? |
| InChIKey | BRIDABZSKYEEOL-NDYUYGHWSA-N |
| XLogP | 3.18 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|