C14H19F4N3OS — CID 174076615
[[3-amino-2-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylpropylidene]amino]methanol (PubChem CID 174076615) has the molecular formula C14H19F4N3OS and a molecular weight of 353.39 g/mol. Its IUPAC name is [[3-amino-2-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylpropylidene]amino]methanol.
| Compound Name | [[3-amino-2-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylpropylidene]amino]methanol |
|---|---|
| PubChem CID | 174076615 |
| Molecular Formula | C14H19F4N3OS |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [[3-amino-2-[ethyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylpropylidene]amino]methanol |
| SMILES | CCN(SC(C=NCO)CN)C(c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H19F4N3OS/c1-2-21(23-12(7-19)8-20-9-22)13(14(16,17)18)10-3-5-11(15)6-4-10/h3-6,8,12-13,22H,2,7,9,19H2,1H3 |
| InChIKey | DLJQBICLEPZTFN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|