C22H39N4O8PS — CID 174077650
propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[5-[[(Z)-3-formamido-3-iminoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy]phosphoryl]amino]acetate (PubChem CID 174077650) has the molecular formula C22H39N4O8PS and a molecular weight of 550.62 g/mol. Its IUPAC name is propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[5-[[(Z)-3-formamido-3-iminoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy]phosphoryl]amino]acetate.
| Compound Name | propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[5-[[(Z)-3-formamido-3-iminoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy]phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 174077650 |
| Molecular Formula | C22H39N4O8PS |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[5-[[(Z)-3-formamido-3-iminoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy]phosphoryl]amino]acetate |
| SMILES | [H]/N=C(/C=C\N(C)C1CCC(COP(=O)(NCC(=O)OC(C)C)OCCSC(=O)C(C)(C)C)O1)NC=O |
| InChI | InChI=1S/C22H39N4O8PS/c1-16(2)33-20(28)13-25-35(30,31-11-12-36-21(29)22(3,4)5)32-14-17-7-8-19(34-17)26(6)10-9-18(23)24-15-27/h9-10,15-17,19H,7-8,11-14H2,1-6H3,(H,25,30)(H2,23,24,27)/b10-9- |
| InChIKey | FZDWEORYBGFEOZ-KTKRTIGZSA-N |
| XLogP | 2.65 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|