C23H29IN6O2S2 — CID 174078013
tert-butyl-[[(1S)-1'-(3-iodo-4-oxo-2,5-dihydropyrazolo[3,4-d]pyrimidin-6-yl)-6-methylsulfanylspiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-oxidosulfanium (PubChem CID 174078013) has the molecular formula C23H29IN6O2S2 and a molecular weight of 612.56 g/mol. Its IUPAC name is tert-butyl-[[(1S)-1'-(3-iodo-4-oxo-2,5-dihydropyrazolo[3,4-d]pyrimidin-6-yl)-6-methylsulfanylspiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-1'-(3-iodo-4-oxo-2,5-dihydropyrazolo[3,4-d]pyrimidin-6-yl)-6-methylsulfanylspiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174078013 |
| Molecular Formula | C23H29IN6O2S2 |
| Molecular Weight | 612.56 g/mol |
| Exact Mass | 612.08 |
| IUPAC Name | tert-butyl-[[(1S)-1'-(3-iodo-4-oxo-2,5-dihydropyrazolo[3,4-d]pyrimidin-6-yl)-6-methylsulfanylspiro[1,3-dihydroindene-2,4'-piperidine]-1-yl]amino]-oxidosulfanium |
| SMILES | CSc1ccc2c(c1)[C@@H](N[S+]([O-])C(C)(C)C)C1(CCN(c3nc4n[nH]c(I)c4c(=O)[nH]3)CC1)C2 |
| InChI | InChI=1S/C23H29IN6O2S2/c1-22(2,3)34(32)29-17-15-11-14(33-4)6-5-13(15)12-23(17)7-9-30(10-8-23)21-25-19-16(20(31)26-21)18(24)27-28-19/h5-6,11,17,29H,7-10,12H2,1-4H3,(H2,25,26,27,28,31)/t17-,34?/m1/s1 |
| InChIKey | KTPHOCXIZDNDFB-DZKOEQQVSA-N |
| XLogP | 3.91 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|