C20H20BN3O3 — CID 174078375
CID 174078375 (PubChem CID 174078375) has the molecular formula C20H20BN3O3 and a molecular weight of 361.21 g/mol.
| Compound Name | CID 174078375 |
|---|---|
| PubChem CID | 174078375 |
| Molecular Formula | C20H20BN3O3 |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | — |
| SMILES | [B]c1cccc2c1c(O)c(C(=O)Nc1ncccc1C)c(=O)n2CC(C)C |
| InChI | InChI=1S/C20H20BN3O3/c1-11(2)10-24-14-8-4-7-13(21)15(14)17(25)16(20(24)27)19(26)23-18-12(3)6-5-9-22-18/h4-9,11,25H,10H2,1-3H3,(H,22,23,26) |
| InChIKey | JKGNNXTWDKQJIK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|