About CID 174078375
CID 174078375 (PubChem CID 174078375) has the molecular formula C20H20BN3O3
and a molecular weight of 361.21 g/mol.
Molecular Properties
| Compound Name | CID 174078375 |
| PubChem CID | 174078375 |
| Molecular Formula | C20H20BN3O3 |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | — |
| SMILES | [B]c1cccc2c1c(O)c(C(=O)Nc1ncccc1C)c(=O)n2CC(C)C |
| InChI | InChI=1S/C20H20BN3O3/c1-11(2)10-24-14-8-4-7-13(21)15(14)17(25)16(20(24)27)19(26)23-18-12(3)6-5-9-22-18/h4-9,11,25H,10H2,1-3H3,(H,22,23,26) |
| InChIKey | JKGNNXTWDKQJIK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174078375 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174078375?
The IUPAC name of CID 174078375 (CID 174078375) is not available.
What is the SMILES notation for CID 174078375?
The canonical SMILES for CID 174078375 is [B]c1cccc2c1c(O)c(C(=O)Nc1ncccc1C)c(=O)n2CC(C)C.
What is the InChIKey of CID 174078375?
The InChIKey is JKGNNXTWDKQJIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20BN3O3/c1-11(2)10-24-14-8-4-7-13(21)15(14)17(25)16(20(24)27)19(26)23-18-12(3)6-5-9-22-18/h4-9,11,25H,10H2,1-3H3,(H,22,23,26).
What are the key properties of CID 174078375?
CID 174078375 has a molecular weight of 361.21 g/mol, XLogP of 2.11, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174078375 is sourced from PubChem (CID 174078375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).