C18H31FN2 — CID 174078585
N-[(4Z,6E)-12-fluoro-9-methylidene-6-propyldodeca-4,6-dien-5-yl]-N'-methylmethanimidamide (PubChem CID 174078585) has the molecular formula C18H31FN2 and a molecular weight of 294.46 g/mol. Its IUPAC name is N-[(4Z,6E)-12-fluoro-9-methylidene-6-propyldodeca-4,6-dien-5-yl]-N'-methylmethanimidamide.
| Compound Name | N-[(4Z,6E)-12-fluoro-9-methylidene-6-propyldodeca-4,6-dien-5-yl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 174078585 |
| Molecular Formula | C18H31FN2 |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | N-[(4Z,6E)-12-fluoro-9-methylidene-6-propyldodeca-4,6-dien-5-yl]-N'-methylmethanimidamide |
| SMILES | C=C(C/C=C(CCC)/C(=C/CCC)N/C=N/C)CCCF |
| InChI | InChI=1S/C18H31FN2/c1-5-7-11-18(21-15-20-4)17(9-6-2)13-12-16(3)10-8-14-19/h11,13,15H,3,5-10,12,14H2,1-2,4H3,(H,20,21)/b17-13+,18-11- |
| InChIKey | VRQOYYZRJRHWTM-UBIHXLPUSA-N |
| XLogP | 5.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|