About (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine
(1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine (PubChem CID 174079054) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine.
Molecular Properties
| Compound Name | (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine |
| PubChem CID | 174079054 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine |
| SMILES | CC1=CN2/N=C\CCCC=C2C=C1 |
| InChI | InChI=1S/C11H14N2/c1-10-6-7-11-5-3-2-4-8-12-13(11)9-10/h5-9H,2-4H2,1H3/b11-5?,12-8- |
| InChIKey | JJPFMMKBKAJUOI-MASIDHJFSA-N |
| XLogP | 2.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine?
The IUPAC name of (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine (CID 174079054) is (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine.
What is the SMILES notation for (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine?
The canonical SMILES for (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine is CC1=CN2/N=C\CCCC=C2C=C1.
What is the InChIKey of (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine?
The InChIKey is JJPFMMKBKAJUOI-MASIDHJFSA-N. The full InChI is InChI=1S/C11H14N2/c1-10-6-7-11-5-3-2-4-8-12-13(11)9-10/h5-9H,2-4H2,1H3/b11-5?,12-8-.
What are the key properties of (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine?
(1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine has a molecular weight of 174.25 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-9-methyl-4,5-dihydro-3H-pyrido[1,2-b]diazocine is sourced from PubChem (CID 174079054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).