C17H13B4FN6O2S2 — CID 174079149
CID 174079149 (PubChem CID 174079149) has the molecular formula C17H13B4FN6O2S2 and a molecular weight of 459.71 g/mol.
| Compound Name | CID 174079149 |
|---|---|
| PubChem CID | 174079149 |
| Molecular Formula | C17H13B4FN6O2S2 |
| Molecular Weight | 459.71 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | — |
| SMILES | [B]C1([B])CC(c2cn3ncnc3c(F)c2C)CC([B])([B])N1S(=O)(=O)c1cnc2sccn12 |
| InChI | InChI=1S/C17H13B4FN6O2S2/c1-9-11(7-27-14(13(9)22)24-8-25-27)10-4-16(18,19)28(17(20,21)5-10)32(29,30)12-6-23-15-26(12)2-3-31-15/h2-3,6-8,10H,4-5H2,1H3 |
| InChIKey | BYWMTUQSXDPSPN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.71 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|