C13H15F3N2O3S — CID 17407981
1-methylsulfonyl-N-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 17407981) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 17407981 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-methylsulfonyl-N-[4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC1C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3N2O3S/c1-22(20,21)18-8-2-3-11(18)12(19)17-10-6-4-9(5-7-10)13(14,15)16/h4-7,11H,2-3,8H2,1H3,(H,17,19) |
| InChIKey | JQVQKWAGIMKELK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |