C10H11NS — CID 174079837
(3aE,7Z)-2-methyl-5,6-dihydrothieno[2,3-b]azocine (PubChem CID 174079837) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is (3aE,7Z)-2-methyl-5,6-dihydrothieno[2,3-b]azocine.
| Compound Name | (3aE,7Z)-2-methyl-5,6-dihydrothieno[2,3-b]azocine |
|---|---|
| PubChem CID | 174079837 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (3aE,7Z)-2-methyl-5,6-dihydrothieno[2,3-b]azocine |
| SMILES | Cc1cc2/c(s1)=N\C=C/CC/C=2 |
| InChI | InChI=1S/C10H11NS/c1-8-7-9-5-3-2-4-6-11-10(9)12-8/h4-7H,2-3H2,1H3/b6-4-,9-5-,11-10+ |
| InChIKey | HPYSFURAUDCBQK-FXWHYSKNSA-N |
| XLogP | 1.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |