C39H46N3Si+ — CID 174079997
2-N-methyl-2-N-[3-[2-methyl-7-(3-methylidenepent-4-enyl)-3-trimethylsilyl-6,7-dihydrobenzo[a]quinolizin-5-ium-6-yl]prop-1-en-2-yl]-1-N-phenylbenzene-1,2-diamine (PubChem CID 174079997) has the molecular formula C39H46N3Si+ and a molecular weight of 584.90 g/mol. Its IUPAC name is 2-N-methyl-2-N-[3-[2-methyl-7-(3-methylidenepent-4-enyl)-3-trimethylsilyl-6,7-dihydrobenzo[a]quinolizin-5-ium-6-yl]prop-1-en-2-yl]-1-N-phenylbenzene-1,2-diamine.
| Compound Name | 2-N-methyl-2-N-[3-[2-methyl-7-(3-methylidenepent-4-enyl)-3-trimethylsilyl-6,7-dihydrobenzo[a]quinolizin-5-ium-6-yl]prop-1-en-2-yl]-1-N-phenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 174079997 |
| Molecular Formula | C39H46N3Si+ |
| Molecular Weight | 584.90 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | 2-N-methyl-2-N-[3-[2-methyl-7-(3-methylidenepent-4-enyl)-3-trimethylsilyl-6,7-dihydrobenzo[a]quinolizin-5-ium-6-yl]prop-1-en-2-yl]-1-N-phenylbenzene-1,2-diamine |
| SMILES | C=CC(=C)CCC1c2ccccc2-c2cc(C)c([Si](C)(C)C)c[n+]2C1CC(=C)N(C)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C39H46N3Si/c1-9-28(2)23-24-34-32-19-13-14-20-33(32)37-25-29(3)39(43(6,7)8)27-42(37)38(34)26-30(4)41(5)36-22-16-15-21-35(36)40-31-17-11-10-12-18-31/h9-22,25,27,34,38,40H,1-2,4,23-24,26H2,3,5-8H3/q+1 |
| InChIKey | XCNJCUJROQVFOA-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 19.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.90 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|