C29H40NSi+ — CID 174080149
[6-ethenyl-10-methyl-7-[(Z)-3-methylidenehex-4-enyl]-2-propyl-6,7-dihydrobenzo[a]quinolizin-5-ium-3-yl]-trimethylsilane (PubChem CID 174080149) has the molecular formula C29H40NSi+ and a molecular weight of 430.73 g/mol. Its IUPAC name is [6-ethenyl-10-methyl-7-[(Z)-3-methylidenehex-4-enyl]-2-propyl-6,7-dihydrobenzo[a]quinolizin-5-ium-3-yl]-trimethylsilane.
| Compound Name | [6-ethenyl-10-methyl-7-[(Z)-3-methylidenehex-4-enyl]-2-propyl-6,7-dihydrobenzo[a]quinolizin-5-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 174080149 |
| Molecular Formula | C29H40NSi+ |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | [6-ethenyl-10-methyl-7-[(Z)-3-methylidenehex-4-enyl]-2-propyl-6,7-dihydrobenzo[a]quinolizin-5-ium-3-yl]-trimethylsilane |
| SMILES | C=CC1C(CCC(=C)/C=C\C)c2ccc(C)cc2-c2cc(CCC)c([Si](C)(C)C)c[n+]21 |
| InChI | InChI=1S/C29H40NSi/c1-9-12-21(4)14-17-25-24-16-15-22(5)18-26(24)28-19-23(13-10-2)29(31(6,7)8)20-30(28)27(25)11-3/h9,11-12,15-16,18-20,25,27H,3-4,10,13-14,17H2,1-2,5-8H3/q+1/b12-9- |
| InChIKey | OINSKQOYEXKOGD-XFXZXTDPSA-N |
| XLogP | 7.18 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|