C13H14N2O2S — CID 17408043
(E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 17408043) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is (E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17408043 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (E)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1/C=C/C(=O)NC1=NCCS1 |
| InChI | InChI=1S/C13H14N2O2S/c1-17-11-5-3-2-4-10(11)6-7-12(16)15-13-14-8-9-18-13/h2-7H,8-9H2,1H3,(H,14,15,16)/b7-6+ |
| InChIKey | JIMCQYATHHKDJB-VOTSOKGWSA-N |
| XLogP | 1.93 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|