C43H48N3Si+ — CID 174080549
2-N-methyl-2-N-[3-[7-[(Z)-3-methylidenehex-4-enyl]-3-trimethylsilyl-6,7-dihydrobenzo[a]quinolizin-5-ium-6-yl]prop-1-en-2-yl]-1-N-naphthalen-1-ylbenzene-1,2-diamine (PubChem CID 174080549) has the molecular formula C43H48N3Si+ and a molecular weight of 634.96 g/mol. Its IUPAC name is 2-N-methyl-2-N-[3-[7-[(Z)-3-methylidenehex-4-enyl]-3-trimethylsilyl-6,7-dihydrobenzo[a]quinolizin-5-ium-6-yl]prop-1-en-2-yl]-1-N-naphthalen-1-ylbenzene-1,2-diamine.
| Compound Name | 2-N-methyl-2-N-[3-[7-[(Z)-3-methylidenehex-4-enyl]-3-trimethylsilyl-6,7-dihydrobenzo[a]quinolizin-5-ium-6-yl]prop-1-en-2-yl]-1-N-naphthalen-1-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 174080549 |
| Molecular Formula | C43H48N3Si+ |
| Molecular Weight | 634.96 g/mol |
| Exact Mass | 634.36 |
| IUPAC Name | 2-N-methyl-2-N-[3-[7-[(Z)-3-methylidenehex-4-enyl]-3-trimethylsilyl-6,7-dihydrobenzo[a]quinolizin-5-ium-6-yl]prop-1-en-2-yl]-1-N-naphthalen-1-ylbenzene-1,2-diamine |
| SMILES | C=C(/C=C\C)CCC1c2ccccc2-c2ccc([Si](C)(C)C)c[n+]2C1CC(=C)N(C)c1ccccc1Nc1cccc2ccccc12 |
| InChI | InChI=1S/C43H48N3Si/c1-8-16-31(2)25-27-38-36-20-11-12-21-37(36)41-28-26-34(47(5,6)7)30-46(41)43(38)29-32(3)45(4)42-24-14-13-22-40(42)44-39-23-15-18-33-17-9-10-19-35(33)39/h8-24,26,28,30,38,43-44H,2-3,25,27,29H2,1,4-7H3/q+1/b16-8- |
| InChIKey | PDQAKJXLIUWXCN-PXNMLYILSA-N |
| XLogP | 10.67 |
| TPSA | 19.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.96 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|