About N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide
N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 17408071) has the molecular formula C15H16N2O2S
and a molecular weight of 288.37 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide.
Molecular Properties
| Compound Name | N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| PubChem CID | 17408071 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccn1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H16N2O2S/c18-20(19,17-11-14-6-1-2-9-16-14)15-8-7-12-4-3-5-13(12)10-15/h1-2,6-10,17H,3-5,11H2 |
| InChIKey | DWGCMTDMHHKGAF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide?
The IUPAC name of N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide (CID 17408071) is N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide.
What is the SMILES notation for N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide?
The canonical SMILES for N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide is O=S(=O)(NCc1ccccn1)c1ccc2c(c1)CCC2.
What is the InChIKey of N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide?
The InChIKey is DWGCMTDMHHKGAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2S/c18-20(19,17-11-14-6-1-2-9-16-14)15-8-7-12-4-3-5-13(12)10-15/h1-2,6-10,17H,3-5,11H2.
What are the key properties of N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide?
N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide has a molecular weight of 288.37 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(pyridin-2-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide is sourced from PubChem (CID 17408071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).