C48H43BNS — CID 174080858
CID 174080858 (PubChem CID 174080858) has the molecular formula C48H43BNS and a molecular weight of 676.76 g/mol.
| Compound Name | CID 174080858 |
|---|---|
| PubChem CID | 174080858 |
| Molecular Formula | C48H43BNS |
| Molecular Weight | 676.76 g/mol |
| Exact Mass | 676.32 |
| IUPAC Name | — |
| SMILES | CC1=C(/C(C)=C(\C)c2cccc([B]c3c(C)cc4c(c3-c3cccc5c3[nH]c3c6ccccc6sc53)C(C)(C)c3ccccc3-4)c2C)C=CCC1 |
| InChI | InChI=1S/C48H43BNS/c1-27-16-8-9-17-32(27)29(3)30(4)33-20-15-24-40(31(33)5)49-44-28(2)26-38-34-18-10-12-23-39(34)48(6,7)43(38)42(44)36-21-14-22-37-45(36)50-46-35-19-11-13-25-41(35)51-47(37)46/h9-15,17-26,50H,8,16H2,1-7H3/b30-29+ |
| InChIKey | JMLMRPACIRRALK-QVIHXGFCSA-N |
| XLogP | 12.24 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.76 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|