C15H21N5O2S — CID 17408094
6-amino-3-methyl-1-(2-methylpropyl)-5-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]pyrimidine-2,4-dione (PubChem CID 17408094) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 6-amino-3-methyl-1-(2-methylpropyl)-5-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]pyrimidine-2,4-dione.
| Compound Name | 6-amino-3-methyl-1-(2-methylpropyl)-5-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 17408094 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 6-amino-3-methyl-1-(2-methylpropyl)-5-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]pyrimidine-2,4-dione |
| SMILES | C=CCNc1nc(-c2c(N)n(CC(C)C)c(=O)n(C)c2=O)cs1 |
| InChI | InChI=1S/C15H21N5O2S/c1-5-6-17-14-18-10(8-23-14)11-12(16)20(7-9(2)3)15(22)19(4)13(11)21/h5,8-9H,1,6-7,16H2,2-4H3,(H,17,18) |
| InChIKey | YGOZVQUQDMBFOV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|