C16H19N3O2S2 — CID 17408245
4-(2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl)-N-prop-2-enyl-1,3-thiazol-2-amine (PubChem CID 17408245) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-(2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl)-N-prop-2-enyl-1,3-thiazol-2-amine.
| Compound Name | 4-(2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl)-N-prop-2-enyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 17408245 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 4-(2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl)-N-prop-2-enyl-1,3-thiazol-2-amine |
| SMILES | C=CCNc1nc(-c2ccc3c(c2)CC(C)N3S(C)(=O)=O)cs1 |
| InChI | InChI=1S/C16H19N3O2S2/c1-4-7-17-16-18-14(10-22-16)12-5-6-15-13(9-12)8-11(2)19(15)23(3,20)21/h4-6,9-11H,1,7-8H2,2-3H3,(H,17,18) |
| InChIKey | RDHYWRGFXVBOOV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|