C46H40BN3S — CID 174083949
8-[4-[N-(cyclohexen-1-yl)anilino]phenyl]-14,15-dimethyl-4-(N-phenylanilino)-1-aza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12,14-heptaene-6-thiol (PubChem CID 174083949) has the molecular formula C46H40BN3S and a molecular weight of 677.73 g/mol. Its IUPAC name is 8-[4-[N-(cyclohexen-1-yl)anilino]phenyl]-14,15-dimethyl-4-(N-phenylanilino)-1-aza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12,14-heptaene-6-thiol.
| Compound Name | 8-[4-[N-(cyclohexen-1-yl)anilino]phenyl]-14,15-dimethyl-4-(N-phenylanilino)-1-aza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12,14-heptaene-6-thiol |
|---|---|
| PubChem CID | 174083949 |
| Molecular Formula | C46H40BN3S |
| Molecular Weight | 677.73 g/mol |
| Exact Mass | 677.30 |
| IUPAC Name | 8-[4-[N-(cyclohexen-1-yl)anilino]phenyl]-14,15-dimethyl-4-(N-phenylanilino)-1-aza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12,14-heptaene-6-thiol |
| SMILES | Cc1c(C)n2c3c(cccc13)B(c1ccc(N(C3=CCCCC3)c3ccccc3)cc1)c1c(S)cc(N(c3ccccc3)c3ccccc3)cc1-2 |
| InChI | InChI=1S/C46H40BN3S/c1-32-33(2)48-43-30-40(50(37-20-11-5-12-21-37)38-22-13-6-14-23-38)31-44(51)45(43)47(42-25-15-24-41(32)46(42)48)34-26-28-39(29-27-34)49(35-16-7-3-8-17-35)36-18-9-4-10-19-36/h3,5-8,11-18,20-31,51H,4,9-10,19H2,1-2H3 |
| InChIKey | UISFWQDRILRMEQ-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 11.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.73 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|