C7H14N2O — CID 174083967
(3R)-3-ethyl-4-methoxy-1,2,3,4-tetrahydropyridazine (PubChem CID 174083967) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is (3R)-3-ethyl-4-methoxy-1,2,3,4-tetrahydropyridazine.
| Compound Name | (3R)-3-ethyl-4-methoxy-1,2,3,4-tetrahydropyridazine |
|---|---|
| PubChem CID | 174083967 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (3R)-3-ethyl-4-methoxy-1,2,3,4-tetrahydropyridazine |
| SMILES | CC[C@H]1NNC=CC1OC |
| InChI | InChI=1S/C7H14N2O/c1-3-6-7(10-2)4-5-8-9-6/h4-9H,3H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | KJACGQOIPVHSHF-ULUSZKPHSA-N |
| XLogP | 0.40 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |