C25H51I2N15 — CID 174084317
2,5,8,11,14,17,20,23,26,29,32,38,40-tridecaza-37,39-diazonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane diiodide (PubChem CID 174084317) has the molecular formula C25H51I2N15 and a molecular weight of 815.60 g/mol. Its IUPAC name is 2,5,8,11,14,17,20,23,26,29,32,38,40-tridecaza-37,39-diazonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane diiodide.
| Compound Name | 2,5,8,11,14,17,20,23,26,29,32,38,40-tridecaza-37,39-diazonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane diiodide |
|---|---|
| PubChem CID | 174084317 |
| Molecular Formula | C25H51I2N15 |
| Molecular Weight | 815.60 g/mol |
| Exact Mass | 815.25 |
| IUPAC Name | 2,5,8,11,14,17,20,23,26,29,32,38,40-tridecaza-37,39-diazonianonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane diiodide |
| SMILES | C1CNC2C3NC4NC(NC5[NH2+]C(NC6NC(NC([NH2+]3)C2C1)C1NCCNC61)C1NCCNC51)C1NCCNC41.[I-].[I-] |
| InChI | InChI=1S/C25H49N15.2HI/c1-2-10-11(26-3-1)19-33-18(10)34-20-12-13(28-5-4-27-12)22(36-20)38-24-16-17(32-9-8-31-16)25(40-24)39-23-15-14(21(35-19)37-23)29-6-7-30-15;;/h10-40H,1-9H2;2*1H |
| InChIKey | IUMCLAAUHNFONK-UHFFFAOYSA-N |
| XLogP | -15.51 |
| TPSA | 189.61 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.60 |
| LogP ≤ 5 | -15.51 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|