C19H23N5 — CID 174084884
6-(3-amino-1-methyliminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine (PubChem CID 174084884) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 6-(3-amino-1-methyliminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine.
| Compound Name | 6-(3-amino-1-methyliminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine |
|---|---|
| PubChem CID | 174084884 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 6-(3-amino-1-methyliminobut-2-en-2-yl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine |
| SMILES | [H]/N=C/c1c(N)ccc2nc(C(/C=N/C)=C(C)N)c3c(c12)CCCC3 |
| InChI | InChI=1S/C19H23N5/c1-11(21)15(10-23-2)19-13-6-4-3-5-12(13)18-14(9-20)16(22)7-8-17(18)24-19/h7-10,20H,3-6,21-22H2,1-2H3/b15-11?,20-9+,23-10+ |
| InChIKey | HIBVPFKPPUVTBR-OJKJDUOISA-N |
| XLogP | 3.08 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|