C18H20N6 — CID 174084936
4-imino-3-(1-methyl-8,9,10,11-tetrahydro-2H-indazolo[5,4-c][2,7]naphthyridin-7-yl)but-2-en-2-amine (PubChem CID 174084936) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 4-imino-3-(1-methyl-8,9,10,11-tetrahydro-2H-indazolo[5,4-c][2,7]naphthyridin-7-yl)but-2-en-2-amine.
| Compound Name | 4-imino-3-(1-methyl-8,9,10,11-tetrahydro-2H-indazolo[5,4-c][2,7]naphthyridin-7-yl)but-2-en-2-amine |
|---|---|
| PubChem CID | 174084936 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-imino-3-(1-methyl-8,9,10,11-tetrahydro-2H-indazolo[5,4-c][2,7]naphthyridin-7-yl)but-2-en-2-amine |
| SMILES | [H]/N=C/C(=C(C)N)c1nc2ccc3n[nH]c(C)c3c2c2c1CNCC2 |
| InChI | InChI=1S/C18H20N6/c1-9(20)12(7-19)18-13-8-21-6-5-11(13)17-14(22-18)3-4-15-16(17)10(2)23-24-15/h3-4,7,19,21H,5-6,8,20H2,1-2H3,(H,23,24)/b12-9?,19-7+ |
| InChIKey | CGVMXPYUOPZISD-JJBVUIQOSA-N |
| XLogP | 2.40 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|