C17H16F3N5 — CID 174085157
4-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-9-methanimidoyl-2,3-dihydro-1H-cyclopenta[c]quinolin-8-amine (PubChem CID 174085157) has the molecular formula C17H16F3N5 and a molecular weight of 347.34 g/mol. Its IUPAC name is 4-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-9-methanimidoyl-2,3-dihydro-1H-cyclopenta[c]quinolin-8-amine.
| Compound Name | 4-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-9-methanimidoyl-2,3-dihydro-1H-cyclopenta[c]quinolin-8-amine |
|---|---|
| PubChem CID | 174085157 |
| Molecular Formula | C17H16F3N5 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 4-(3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl)-9-methanimidoyl-2,3-dihydro-1H-cyclopenta[c]quinolin-8-amine |
| SMILES | [H]/N=C/C(=C(N)C(F)(F)F)c1nc2ccc(N)c(/C=N/[H])c2c2c1CCC2 |
| InChI | InChI=1S/C17H16F3N5/c18-17(19,20)16(24)11(7-22)15-9-3-1-2-8(9)14-10(6-21)12(23)4-5-13(14)25-15/h4-7,21-22H,1-3,23-24H2/b16-11?,21-6+,22-7+ |
| InChIKey | FXPHNBXQALIWLH-SBPQMQQJSA-N |
| XLogP | 3.19 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|